C22H33FN4O4S — CID 16614919
1-cyclohexyl-3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]urea (PubChem CID 16614919) has the molecular formula C22H33FN4O4S and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]urea |
|---|---|
| PubChem CID | 16614919 |
| Molecular Formula | C22H33FN4O4S |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-cyclohexyl-3-[4-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]-4-oxobutyl]urea |
| SMILES | O=C(NCCCC(=O)N1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C22H33FN4O4S/c23-18-9-11-20(12-10-18)32(30,31)27-15-5-14-26(16-17-27)21(28)8-4-13-24-22(29)25-19-6-2-1-3-7-19/h9-12,19H,1-8,13-17H2,(H2,24,25,29) |
| InChIKey | ALKMENVRUQQBBX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|