C22H30ClFN4O3 — CID 55724164
1-[4-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea (PubChem CID 55724164) has the molecular formula C22H30ClFN4O3 and a molecular weight of 452.96 g/mol. Its IUPAC name is 1-[4-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea.
| Compound Name | 1-[4-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 55724164 |
| Molecular Formula | C22H30ClFN4O3 |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-[4-[4-(5-chloro-2-fluorobenzoyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea |
| SMILES | O=C(NCCCC(=O)N1CCN(C(=O)c2cc(Cl)ccc2F)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C22H30ClFN4O3/c23-16-8-9-19(24)18(15-16)21(30)28-13-11-27(12-14-28)20(29)7-4-10-25-22(31)26-17-5-2-1-3-6-17/h8-9,15,17H,1-7,10-14H2,(H2,25,26,31) |
| InChIKey | BNZQZIPMGBDANZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|