C24H36N4O3 — CID 86938834
4-(cyclohexylcarbamoylamino)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]butanamide (PubChem CID 86938834) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]butanamide |
|---|---|
| PubChem CID | 86938834 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NCCCC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H36N4O3/c29-22(12-6-16-26-24(31)27-21-10-2-1-3-11-21)25-15-7-13-23(30)28-17-14-19-8-4-5-9-20(19)18-28/h4-5,8-9,21H,1-3,6-7,10-18H2,(H,25,29)(H2,26,27,31) |
| InChIKey | LOPLTSDKTOOSET-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|