C21H31FN4O2 — CID 16621551
1-cyclohexyl-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutyl]urea (PubChem CID 16621551) has the molecular formula C21H31FN4O2 and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutyl]urea |
|---|---|
| PubChem CID | 16621551 |
| Molecular Formula | C21H31FN4O2 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-cyclohexyl-3-[4-[4-(4-fluorophenyl)piperazin-1-yl]-4-oxobutyl]urea |
| SMILES | O=C(NCCCC(=O)N1CCN(c2ccc(F)cc2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C21H31FN4O2/c22-17-8-10-19(11-9-17)25-13-15-26(16-14-25)20(27)7-4-12-23-21(28)24-18-5-2-1-3-6-18/h8-11,18H,1-7,12-16H2,(H2,23,24,28) |
| InChIKey | MUFCGZKQCJWBKA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|