C21H30N6O2 — CID 55513437
1-[4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea (PubChem CID 55513437) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea.
| Compound Name | 1-[4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 55513437 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[4-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]-4-oxobutyl]-3-cyclohexylurea |
| SMILES | N#Cc1cccnc1N1CCN(C(=O)CCCNC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H30N6O2/c22-16-17-6-4-10-23-20(17)27-14-12-26(13-15-27)19(28)9-5-11-24-21(29)25-18-7-2-1-3-8-18/h4,6,10,18H,1-3,5,7-9,11-15H2,(H2,24,25,29) |
| InChIKey | VAZLCHWWXSALQN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|