C20H25N7O — CID 118793902
1-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-cyclopentylpyrazol-3-yl)urea (PubChem CID 118793902) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-cyclopentylpyrazol-3-yl)urea.
| Compound Name | 1-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-cyclopentylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 118793902 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-3-(2-cyclopentylpyrazol-3-yl)urea |
| SMILES | N#Cc1cccnc1N1CCC(NC(=O)Nc2ccnn2C2CCCC2)CC1 |
| InChI | InChI=1S/C20H25N7O/c21-14-15-4-3-10-22-19(15)26-12-8-16(9-13-26)24-20(28)25-18-7-11-23-27(18)17-5-1-2-6-17/h3-4,7,10-11,16-17H,1-2,5-6,8-9,12-13H2,(H2,24,25,28) |
| InChIKey | XZRROJDSBIFZJT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |