C16H27N3O4 — CID 119354504
1-[4-(cyclohexylcarbamoylamino)butanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 119354504) has the molecular formula C16H27N3O4 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[4-(cyclohexylcarbamoylamino)butanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-(cyclohexylcarbamoylamino)butanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119354504 |
| Molecular Formula | C16H27N3O4 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 1-[4-(cyclohexylcarbamoylamino)butanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(NCCCC(=O)N1CCC(C(=O)O)C1)NC1CCCCC1 |
| InChI | InChI=1S/C16H27N3O4/c20-14(19-10-8-12(11-19)15(21)22)7-4-9-17-16(23)18-13-5-2-1-3-6-13/h12-13H,1-11H2,(H,21,22)(H2,17,18,23) |
| InChIKey | XDZUYWOJGWHEBH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|