C21H35N3O4 — CID 119175345
6-[6-(cyclohexylcarbamoylamino)hexanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119175345) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is 6-[6-(cyclohexylcarbamoylamino)hexanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-[6-(cyclohexylcarbamoylamino)hexanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 119175345 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 6-[6-(cyclohexylcarbamoylamino)hexanoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | O=C(NCCCCCC(=O)N1CCC2(CC1)CC2C(=O)O)NC1CCCCC1 |
| InChI | InChI=1S/C21H35N3O4/c25-18(24-13-10-21(11-14-24)15-17(21)19(26)27)9-5-2-6-12-22-20(28)23-16-7-3-1-4-8-16/h16-17H,1-15H2,(H,26,27)(H2,22,23,28) |
| InChIKey | UBBHVRSRERXLOV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|