C18H31N3O4 — CID 119365421
(2S)-1-[6-(cyclohexylcarbamoylamino)hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119365421) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is (2S)-1-[6-(cyclohexylcarbamoylamino)hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[6-(cyclohexylcarbamoylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119365421 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | (2S)-1-[6-(cyclohexylcarbamoylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(NCCCCCC(=O)N1CCC[C@H]1C(=O)O)NC1CCCCC1 |
| InChI | InChI=1S/C18H31N3O4/c22-16(21-13-7-10-15(21)17(23)24)11-5-2-6-12-19-18(25)20-14-8-3-1-4-9-14/h14-15H,1-13H2,(H,23,24)(H2,19,20,25)/t15-/m0/s1 |
| InChIKey | PERJQMBYNAMKNV-HNNXBMFYSA-N |
| XLogP | 2.25 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|