C20H39ClN4O2 — CID 119436068
1-[6-[2-(1-aminoethyl)piperidin-1-yl]-6-oxohexyl]-3-cyclohexylurea;hydrochloride (PubChem CID 119436068) has the molecular formula C20H39ClN4O2 and a molecular weight of 403.01 g/mol. Its IUPAC name is 1-[6-[2-(1-aminoethyl)piperidin-1-yl]-6-oxohexyl]-3-cyclohexylurea;hydrochloride.
| Compound Name | 1-[6-[2-(1-aminoethyl)piperidin-1-yl]-6-oxohexyl]-3-cyclohexylurea;hydrochloride |
|---|---|
| PubChem CID | 119436068 |
| Molecular Formula | C20H39ClN4O2 |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 1-[6-[2-(1-aminoethyl)piperidin-1-yl]-6-oxohexyl]-3-cyclohexylurea;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)CCCCCNC(=O)NC1CCCCC1.Cl |
| InChI | InChI=1S/C20H38N4O2.ClH/c1-16(21)18-12-7-9-15-24(18)19(25)13-6-3-8-14-22-20(26)23-17-10-4-2-5-11-17;/h16-18H,2-15,21H2,1H3,(H2,22,23,26);1H |
| InChIKey | ADIQZZNDPOCXQL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|