C21H37N3O2 — CID 55931291
1-cyclohexyl-3-[4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-oxobutyl]urea (PubChem CID 55931291) has the molecular formula C21H37N3O2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-oxobutyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-oxobutyl]urea |
|---|---|
| PubChem CID | 55931291 |
| Molecular Formula | C21H37N3O2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | 1-cyclohexyl-3-[4-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-4-oxobutyl]urea |
| SMILES | CC1CCN(C(=O)CCCNC(=O)NC2CCCCC2)C2CCCCC12 |
| InChI | InChI=1S/C21H37N3O2/c1-16-13-15-24(19-11-6-5-10-18(16)19)20(25)12-7-14-22-21(26)23-17-8-3-2-4-9-17/h16-19H,2-15H2,1H3,(H2,22,23,26) |
| InChIKey | ITNXQDSCKBNGMO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|