C15H29ClN4O2 — CID 119410465
1-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride (PubChem CID 119410465) has the molecular formula C15H29ClN4O2 and a molecular weight of 332.88 g/mol. Its IUPAC name is 1-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride.
| Compound Name | 1-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride |
|---|---|
| PubChem CID | 119410465 |
| Molecular Formula | C15H29ClN4O2 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-[4-[(3R)-3-aminopyrrolidin-1-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(C(=O)CCCNC(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C15H28N4O2.ClH/c16-12-8-10-19(11-12)14(20)7-4-9-17-15(21)18-13-5-2-1-3-6-13;/h12-13H,1-11,16H2,(H2,17,18,21);1H/t12-;/m1./s1 |
| InChIKey | SQEJBJSXDMHHJE-UTONKHPSSA-N |
| XLogP | 1.38 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|