C17H27N5O2 — CID 166206726
1-cyclohexyl-3-[4-(3-imidazol-1-ylazetidin-1-yl)-4-oxobutyl]urea (PubChem CID 166206726) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(3-imidazol-1-ylazetidin-1-yl)-4-oxobutyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(3-imidazol-1-ylazetidin-1-yl)-4-oxobutyl]urea |
|---|---|
| PubChem CID | 166206726 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 1-cyclohexyl-3-[4-(3-imidazol-1-ylazetidin-1-yl)-4-oxobutyl]urea |
| SMILES | O=C(NCCCC(=O)N1CC(n2ccnc2)C1)NC1CCCCC1 |
| InChI | InChI=1S/C17H27N5O2/c23-16(22-11-15(12-22)21-10-9-18-13-21)7-4-8-19-17(24)20-14-5-2-1-3-6-14/h9-10,13-15H,1-8,11-12H2,(H2,19,20,24) |
| InChIKey | XDGYAOMPIIZXBB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|