C16H31ClN4O2 — CID 119378516
1-[4-(3-aminopiperidin-1-yl)-4-oxobutyl]-3-cyclohexylurea;hydrochloride (PubChem CID 119378516) has the molecular formula C16H31ClN4O2 and a molecular weight of 346.90 g/mol. Its IUPAC name is 1-[4-(3-aminopiperidin-1-yl)-4-oxobutyl]-3-cyclohexylurea;hydrochloride.
| Compound Name | 1-[4-(3-aminopiperidin-1-yl)-4-oxobutyl]-3-cyclohexylurea;hydrochloride |
|---|---|
| PubChem CID | 119378516 |
| Molecular Formula | C16H31ClN4O2 |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-[4-(3-aminopiperidin-1-yl)-4-oxobutyl]-3-cyclohexylurea;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)CCCNC(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C16H30N4O2.ClH/c17-13-6-5-11-20(12-13)15(21)9-4-10-18-16(22)19-14-7-2-1-3-8-14;/h13-14H,1-12,17H2,(H2,18,19,22);1H |
| InChIKey | NBACNZCBBBBIMM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|