C17H31ClN4O2 — CID 120656749
1-[4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride (PubChem CID 120656749) has the molecular formula C17H31ClN4O2 and a molecular weight of 358.91 g/mol. Its IUPAC name is 1-[4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride.
| Compound Name | 1-[4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride |
|---|---|
| PubChem CID | 120656749 |
| Molecular Formula | C17H31ClN4O2 |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-4-oxobutyl]-3-cyclohexylurea;hydrochloride |
| SMILES | Cl.O=C(NCCCC(=O)N1C[C@H]2CNC[C@H]2C1)NC1CCCCC1 |
| InChI | InChI=1S/C17H30N4O2.ClH/c22-16(21-11-13-9-18-10-14(13)12-21)7-4-8-19-17(23)20-15-5-2-1-3-6-15;/h13-15,18H,1-12H2,(H2,19,20,23);1H/t13-,14+; |
| InChIKey | KNGDEGRAQFBNDA-KAECKJJSSA-N |
| XLogP | 1.50 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|