C17H33ClN4O2 — CID 119534786
4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-3-ylethyl)butanamide;hydrochloride (PubChem CID 119534786) has the molecular formula C17H33ClN4O2 and a molecular weight of 360.93 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-3-ylethyl)butanamide;hydrochloride.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-3-ylethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119534786 |
| Molecular Formula | C17H33ClN4O2 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-3-ylethyl)butanamide;hydrochloride |
| SMILES | Cl.O=C(CCCNC(=O)NC1CCCCC1)NCCC1CCNC1 |
| InChI | InChI=1S/C17H32N4O2.ClH/c22-16(19-12-9-14-8-11-18-13-14)7-4-10-20-17(23)21-15-5-2-1-3-6-15;/h14-15,18H,1-13H2,(H,19,22)(H2,20,21,23);1H |
| InChIKey | ORZSVXYDLBLAML-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|