C16H30N4O2 — CID 119425673
4-(cyclohexylcarbamoylamino)-N-piperidin-3-ylbutanamide (PubChem CID 119425673) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-piperidin-3-ylbutanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119425673 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-piperidin-3-ylbutanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NC1CCCNC1 |
| InChI | InChI=1S/C16H30N4O2/c21-15(19-14-8-4-10-17-12-14)9-5-11-18-16(22)20-13-6-2-1-3-7-13/h13-14,17H,1-12H2,(H,19,21)(H2,18,20,22) |
| InChIKey | NGFJEQHMNPMKIP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|