C14H27N3O2 — CID 119426962
2,2-dimethyl-N-[4-oxo-4-(piperidin-3-ylamino)butyl]propanamide (PubChem CID 119426962) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-oxo-4-(piperidin-3-ylamino)butyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-oxo-4-(piperidin-3-ylamino)butyl]propanamide |
|---|---|
| PubChem CID | 119426962 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2,2-dimethyl-N-[4-oxo-4-(piperidin-3-ylamino)butyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)NC1CCCNC1 |
| InChI | InChI=1S/C14H27N3O2/c1-14(2,3)13(19)16-9-5-7-12(18)17-11-6-4-8-15-10-11/h11,15H,4-10H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | AUMNIZPBAPRMQQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|