C21H37N3O3 — CID 55706617
N-[4-[[1-(cyclohexanecarbonyl)piperidin-4-yl]amino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 55706617) has the molecular formula C21H37N3O3 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-[4-[[1-(cyclohexanecarbonyl)piperidin-4-yl]amino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[[1-(cyclohexanecarbonyl)piperidin-4-yl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 55706617 |
| Molecular Formula | C21H37N3O3 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.28 |
| IUPAC Name | N-[4-[[1-(cyclohexanecarbonyl)piperidin-4-yl]amino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCC(=O)NC1CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H37N3O3/c1-21(2,3)20(27)22-13-7-10-18(25)23-17-11-14-24(15-12-17)19(26)16-8-5-4-6-9-16/h16-17H,4-15H2,1-3H3,(H,22,27)(H,23,25) |
| InChIKey | JXHAVCJTZNKEHB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|