C16H30N4O2 — CID 119415459
1-cyclohexyl-3-[4-(1,4-diazepan-1-yl)-4-oxobutyl]urea (PubChem CID 119415459) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(1,4-diazepan-1-yl)-4-oxobutyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(1,4-diazepan-1-yl)-4-oxobutyl]urea |
|---|---|
| PubChem CID | 119415459 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-cyclohexyl-3-[4-(1,4-diazepan-1-yl)-4-oxobutyl]urea |
| SMILES | O=C(NCCCC(=O)N1CCCNCC1)NC1CCCCC1 |
| InChI | InChI=1S/C16H30N4O2/c21-15(20-12-5-9-17-11-13-20)8-4-10-18-16(22)19-14-6-2-1-3-7-14/h14,17H,1-13H2,(H2,18,19,22) |
| InChIKey | GZHKYDMDRDBIGR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|