C19H36ClN5O2 — CID 120981215
1-cyclohexyl-3-[1-(3-oxo-3-piperazin-1-ylpropyl)piperidin-4-yl]urea;hydrochloride (PubChem CID 120981215) has the molecular formula C19H36ClN5O2 and a molecular weight of 401.98 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(3-oxo-3-piperazin-1-ylpropyl)piperidin-4-yl]urea;hydrochloride.
| Compound Name | 1-cyclohexyl-3-[1-(3-oxo-3-piperazin-1-ylpropyl)piperidin-4-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 120981215 |
| Molecular Formula | C19H36ClN5O2 |
| Molecular Weight | 401.98 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 1-cyclohexyl-3-[1-(3-oxo-3-piperazin-1-ylpropyl)piperidin-4-yl]urea;hydrochloride |
| SMILES | Cl.O=C(NC1CCCCC1)NC1CCN(CCC(=O)N2CCNCC2)CC1 |
| InChI | InChI=1S/C19H35N5O2.ClH/c25-18(24-14-9-20-10-15-24)8-13-23-11-6-17(7-12-23)22-19(26)21-16-4-2-1-3-5-16;/h16-17,20H,1-15H2,(H2,21,22,26);1H |
| InChIKey | LLOMKBOUQFHLKF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.98 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |