C18H32N4O2 — CID 119304273
1-cyclohexyl-3-[1-(piperidine-4-carbonyl)piperidin-4-yl]urea (PubChem CID 119304273) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(piperidine-4-carbonyl)piperidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-(piperidine-4-carbonyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 119304273 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 1-cyclohexyl-3-[1-(piperidine-4-carbonyl)piperidin-4-yl]urea |
| SMILES | O=C(NC1CCCCC1)NC1CCN(C(=O)C2CCNCC2)CC1 |
| InChI | InChI=1S/C18H32N4O2/c23-17(14-6-10-19-11-7-14)22-12-8-16(9-13-22)21-18(24)20-15-4-2-1-3-5-15/h14-16,19H,1-13H2,(H2,20,21,24) |
| InChIKey | HVJOPMSLZNJVBF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |