C17H31ClN4O3 — CID 119750464
1-cyclohexyl-3-[1-(morpholine-3-carbonyl)piperidin-4-yl]urea;hydrochloride (PubChem CID 119750464) has the molecular formula C17H31ClN4O3 and a molecular weight of 374.91 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(morpholine-3-carbonyl)piperidin-4-yl]urea;hydrochloride.
| Compound Name | 1-cyclohexyl-3-[1-(morpholine-3-carbonyl)piperidin-4-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 119750464 |
| Molecular Formula | C17H31ClN4O3 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 1-cyclohexyl-3-[1-(morpholine-3-carbonyl)piperidin-4-yl]urea;hydrochloride |
| SMILES | Cl.O=C(NC1CCCCC1)NC1CCN(C(=O)C2COCCN2)CC1 |
| InChI | InChI=1S/C17H30N4O3.ClH/c22-16(15-12-24-11-8-18-15)21-9-6-14(7-10-21)20-17(23)19-13-4-2-1-3-5-13;/h13-15,18H,1-12H2,(H2,19,20,23);1H |
| InChIKey | ZZTKVZGBFKPYDL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |