C9H17ClN2O3 — CID 130608601
[(3S)-3-hydroxypyrrolidin-1-yl]-[(3R)-morpholin-3-yl]methanone;hydrochloride (PubChem CID 130608601) has the molecular formula C9H17ClN2O3 and a molecular weight of 236.70 g/mol. Its IUPAC name is [(3S)-3-hydroxypyrrolidin-1-yl]-[(3R)-morpholin-3-yl]methanone;hydrochloride.
| Compound Name | [(3S)-3-hydroxypyrrolidin-1-yl]-[(3R)-morpholin-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 130608601 |
| Molecular Formula | C9H17ClN2O3 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | [(3S)-3-hydroxypyrrolidin-1-yl]-[(3R)-morpholin-3-yl]methanone;hydrochloride |
| SMILES | Cl.O=C([C@H]1COCCN1)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C9H16N2O3.ClH/c12-7-1-3-11(5-7)9(13)8-6-14-4-2-10-8;/h7-8,10,12H,1-6H2;1H/t7-,8+;/m0./s1 |
| InChIKey | DAPJZCBAKWUBKA-KZYPOYLOSA-N |
| XLogP | -1.01 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |