C15H30ClN5O2 — CID 119448567
2-(cyclohexylcarbamoylamino)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride (PubChem CID 119448567) has the molecular formula C15H30ClN5O2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoylamino)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride.
| Compound Name | 2-(cyclohexylcarbamoylamino)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119448567 |
| Molecular Formula | C15H30ClN5O2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-(cyclohexylcarbamoylamino)-N-(2-piperazin-1-ylethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CNC(=O)NC1CCCCC1)NCCN1CCNCC1 |
| InChI | InChI=1S/C15H29N5O2.ClH/c21-14(17-8-11-20-9-6-16-7-10-20)12-18-15(22)19-13-4-2-1-3-5-13;/h13,16H,1-12H2,(H,17,21)(H2,18,19,22);1H |
| InChIKey | GWDVSUADZCPTAJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |