C17H33ClN4O2 — CID 119391449
2-cyclohexyl-N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]acetamide;hydrochloride (PubChem CID 119391449) has the molecular formula C17H33ClN4O2 and a molecular weight of 360.93 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-cyclohexyl-N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119391449 |
| Molecular Formula | C17H33ClN4O2 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-cyclohexyl-N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CNC(=O)CC1CCCCC1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C17H32N4O2.ClH/c22-16(13-15-5-2-1-3-6-15)20-14-17(23)19-7-4-10-21-11-8-18-9-12-21;/h15,18H,1-14H2,(H,19,23)(H,20,22);1H |
| InChIKey | LNLSXPIYZBPSJA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|