C17H40N4O — CID 177321931
ethane;molecular hydrogen;N-(2-piperazin-1-ylethyl)-2-piperidin-4-ylacetamide (PubChem CID 177321931) has the molecular formula C17H40N4O and a molecular weight of 316.53 g/mol. Its IUPAC name is ethane;molecular hydrogen;N-(2-piperazin-1-ylethyl)-2-piperidin-4-ylacetamide.
| Compound Name | ethane;molecular hydrogen;N-(2-piperazin-1-ylethyl)-2-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 177321931 |
| Molecular Formula | C17H40N4O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.32 |
| IUPAC Name | ethane;molecular hydrogen;N-(2-piperazin-1-ylethyl)-2-piperidin-4-ylacetamide |
| SMILES | CC.CC.O=C(CC1CCNCC1)NCCN1CCNCC1.[H][H] |
| InChI | InChI=1S/C13H26N4O.2C2H6.H2/c18-13(11-12-1-3-14-4-2-12)16-7-10-17-8-5-15-6-9-17;2*1-2;/h12,14-15H,1-11H2,(H,16,18);2*1-2H3;1H |
| InChIKey | ZJOWQTHUCCUOCB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |