C18H44N4O — CID 177321914
ethane;molecular hydrogen;2-piperazin-1-yl-N-(piperidin-4-ylmethyl)acetamide (PubChem CID 177321914) has the molecular formula C18H44N4O and a molecular weight of 332.58 g/mol. Its IUPAC name is ethane;molecular hydrogen;2-piperazin-1-yl-N-(piperidin-4-ylmethyl)acetamide.
| Compound Name | ethane;molecular hydrogen;2-piperazin-1-yl-N-(piperidin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 177321914 |
| Molecular Formula | C18H44N4O |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.35 |
| IUPAC Name | ethane;molecular hydrogen;2-piperazin-1-yl-N-(piperidin-4-ylmethyl)acetamide |
| SMILES | CC.CC.CC.O=C(CN1CCNCC1)NCC1CCNCC1.[H][H] |
| InChI | InChI=1S/C12H24N4O.3C2H6.H2/c17-12(10-16-7-5-14-6-8-16)15-9-11-1-3-13-4-2-11;3*1-2;/h11,13-14H,1-10H2,(H,15,17);3*1-2H3;1H |
| InChIKey | HZXTYFIFUZRZGK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |