C13H25N3O2 — CID 55228378
2-(1,4-diazepan-1-yl)-N-(oxan-4-ylmethyl)acetamide (PubChem CID 55228378) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 55228378 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(oxan-4-ylmethyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)NCC1CCOCC1 |
| InChI | InChI=1S/C13H25N3O2/c17-13(11-16-6-1-4-14-5-7-16)15-10-12-2-8-18-9-3-12/h12,14H,1-11H2,(H,15,17) |
| InChIKey | DMMDQWYHRCJQDO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |