C14H26N4O2 — CID 79401234
N-cyclopropyl-4-[[2-(1,4-diazepan-1-yl)acetyl]amino]butanamide (PubChem CID 79401234) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-cyclopropyl-4-[[2-(1,4-diazepan-1-yl)acetyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[2-(1,4-diazepan-1-yl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 79401234 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-cyclopropyl-4-[[2-(1,4-diazepan-1-yl)acetyl]amino]butanamide |
| SMILES | O=C(CN1CCCNCC1)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H26N4O2/c19-13(17-12-4-5-12)3-1-7-16-14(20)11-18-9-2-6-15-8-10-18/h12,15H,1-11H2,(H,16,20)(H,17,19) |
| InChIKey | ZWTUYNJMWHOYLJ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|