C12H25N3O2 — CID 107317788
2-(1,4-diazepan-1-yl)-N-(5-hydroxypentyl)acetamide (PubChem CID 107317788) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(5-hydroxypentyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(5-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 107317788 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(5-hydroxypentyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)NCCCCCO |
| InChI | InChI=1S/C12H25N3O2/c16-10-3-1-2-6-14-12(17)11-15-8-4-5-13-7-9-15/h13,16H,1-11H2,(H,14,17) |
| InChIKey | MIYLAAXHPOLDBF-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|