2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid

C11H21N3O4 — CID 79456856

IUPAC2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid
SMILESO=C(O)COCCNC(=O)CN1CCCNCC1
InChIInChI=1S/C11H21N3O4/c15-10(13-4-7-18-9-11(16)17)8-14-5-1-2-12-3-6-14/h12H,1-9H2,(H,13,15)(H,16,17)
InChIKeyNZABBOOLOSGKAV-UHFFFAOYSA-N
MW259.31 g/mol
LogP-1.50
Rot. Bonds7

About 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid

2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid (PubChem CID 79456856) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid
PubChem CID79456856
Molecular FormulaC11H21N3O4
Molecular Weight259.31 g/mol
Exact Mass259.15
IUPAC Name2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid
SMILESO=C(O)COCCNC(=O)CN1CCCNCC1
InChIInChI=1S/C11H21N3O4/c15-10(13-4-7-18-9-11(16)17)8-14-5-1-2-12-3-6-14/h12H,1-9H2,(H,13,15)(H,16,17)
InChIKeyNZABBOOLOSGKAV-UHFFFAOYSA-N
XLogP-1.50
TPSA90.90 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.31
LogP ≤ 5-1.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid?
The IUPAC name of 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid (CID 79456856) is 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid.
What is the SMILES notation for 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid?
The canonical SMILES for 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid is O=C(O)COCCNC(=O)CN1CCCNCC1.
What is the InChIKey of 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid?
The InChIKey is NZABBOOLOSGKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O4/c15-10(13-4-7-18-9-11(16)17)8-14-5-1-2-12-3-6-14/h12H,1-9H2,(H,13,15)(H,16,17).
What are the key properties of 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid?
2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid has a molecular weight of 259.31 g/mol, XLogP of -1.50, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid is sourced from PubChem (CID 79456856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).