C11H21N3O4 — CID 79456856
2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid (PubChem CID 79456856) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79456856 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C11H21N3O4/c15-10(13-4-7-18-9-11(16)17)8-14-5-1-2-12-3-6-14/h12H,1-9H2,(H,13,15)(H,16,17) |
| InChIKey | NZABBOOLOSGKAV-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|