C12H25N3O3 — CID 106247485
2-(1,4-diazepan-1-yl)-N-(3-hydroxy-4-methoxybutyl)acetamide (PubChem CID 106247485) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(3-hydroxy-4-methoxybutyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(3-hydroxy-4-methoxybutyl)acetamide |
|---|---|
| PubChem CID | 106247485 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(3-hydroxy-4-methoxybutyl)acetamide |
| SMILES | COCC(O)CCNC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C12H25N3O3/c1-18-10-11(16)3-5-14-12(17)9-15-7-2-4-13-6-8-15/h11,13,16H,2-10H2,1H3,(H,14,17) |
| InChIKey | XSNUZEMXJXWJDG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |