C13H26N4O2 — CID 62839250
N-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethyl]-2-methylpropanamide (PubChem CID 62839250) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 62839250 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[2-[[2-(1,4-diazepan-1-yl)acetyl]amino]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C13H26N4O2/c1-11(2)13(19)16-6-5-15-12(18)10-17-8-3-4-14-7-9-17/h11,14H,3-10H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | ONSXHCSHOOZAHV-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|