4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid

C12H23N3O3 — CID 81073099

IUPAC4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid
SMILESCC(CNC(=O)CN1CCCNCC1)CC(=O)O
InChIInChI=1S/C12H23N3O3/c1-10(7-12(17)18)8-14-11(16)9-15-5-2-3-13-4-6-15/h10,13H,2-9H2,1H3,(H,14,16)(H,17,18)
InChIKeyLOZIONVARAZKJU-UHFFFAOYSA-N
MW257.33 g/mol
LogP-0.49
Rot. Bonds6

About 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid

4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 81073099) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid.

Molecular Properties

Compound Name4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid
PubChem CID81073099
Molecular FormulaC12H23N3O3
Molecular Weight257.33 g/mol
Exact Mass257.17
IUPAC Name4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid
SMILESCC(CNC(=O)CN1CCCNCC1)CC(=O)O
InChIInChI=1S/C12H23N3O3/c1-10(7-12(17)18)8-14-11(16)9-15-5-2-3-13-4-6-15/h10,13H,2-9H2,1H3,(H,14,16)(H,17,18)
InChIKeyLOZIONVARAZKJU-UHFFFAOYSA-N
XLogP-0.49
TPSA81.67 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 5-0.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid?
The IUPAC name of 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid (CID 81073099) is 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid.
What is the SMILES notation for 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid?
The canonical SMILES for 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid is CC(CNC(=O)CN1CCCNCC1)CC(=O)O.
What is the InChIKey of 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid?
The InChIKey is LOZIONVARAZKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O3/c1-10(7-12(17)18)8-14-11(16)9-15-5-2-3-13-4-6-15/h10,13H,2-9H2,1H3,(H,14,16)(H,17,18).
What are the key properties of 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid?
4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid has a molecular weight of 257.33 g/mol, XLogP of -0.49, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoic acid is sourced from PubChem (CID 81073099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).