C10H21N3O3S — CID 62837051
2-(1,4-diazepan-1-yl)-N-(2-methylsulfonylethyl)acetamide (PubChem CID 62837051) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2-methylsulfonylethyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2-methylsulfonylethyl)acetamide |
|---|---|
| PubChem CID | 62837051 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2-methylsulfonylethyl)acetamide |
| SMILES | CS(=O)(=O)CCNC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C10H21N3O3S/c1-17(15,16)8-5-12-10(14)9-13-6-2-3-11-4-7-13/h11H,2-9H2,1H3,(H,12,14) |
| InChIKey | IQNAZUMIDRDKCJ-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |