C12H24N4O2 — CID 106235926
5-[[2-(1,4-diazepan-1-yl)acetyl]amino]pentanamide (PubChem CID 106235926) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 5-[[2-(1,4-diazepan-1-yl)acetyl]amino]pentanamide.
| Compound Name | 5-[[2-(1,4-diazepan-1-yl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 106235926 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 5-[[2-(1,4-diazepan-1-yl)acetyl]amino]pentanamide |
| SMILES | NC(=O)CCCCNC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C12H24N4O2/c13-11(17)4-1-2-6-15-12(18)10-16-8-3-5-14-7-9-16/h14H,1-10H2,(H2,13,17)(H,15,18) |
| InChIKey | XBPKVTYBTQCMJE-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|