C7H16N4O — CID 63577135
2-(1,4-diazepan-1-yl)acetohydrazide (PubChem CID 63577135) has the molecular formula C7H16N4O and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)acetohydrazide.
| Compound Name | 2-(1,4-diazepan-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 63577135 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)acetohydrazide |
| SMILES | NNC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C7H16N4O/c8-10-7(12)6-11-4-1-2-9-3-5-11/h9H,1-6,8H2,(H,10,12) |
| InChIKey | IMZLMBNJDPOZDA-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|