methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate

C13H25N3O3 — CID 62839439

IUPACmethyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate
SMILESCOC(=O)C(NC(=O)CN1CCCNCC1)C(C)C
InChIInChI=1S/C13H25N3O3/c1-10(2)12(13(18)19-3)15-11(17)9-16-7-4-5-14-6-8-16/h10,12,14H,4-9H2,1-3H3,(H,15,17)
InChIKeyZUVQPNMHGBAONP-UHFFFAOYSA-N
MW271.36 g/mol
LogP-0.40
Rot. Bonds5

About methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate

methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate (PubChem CID 62839439) has the molecular formula C13H25N3O3 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate.

Molecular Properties

Compound Namemethyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate
PubChem CID62839439
Molecular FormulaC13H25N3O3
Molecular Weight271.36 g/mol
Exact Mass271.19
IUPAC Namemethyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate
SMILESCOC(=O)C(NC(=O)CN1CCCNCC1)C(C)C
InChIInChI=1S/C13H25N3O3/c1-10(2)12(13(18)19-3)15-11(17)9-16-7-4-5-14-6-8-16/h10,12,14H,4-9H2,1-3H3,(H,15,17)
InChIKeyZUVQPNMHGBAONP-UHFFFAOYSA-N
XLogP-0.40
TPSA70.67 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.36
LogP ≤ 5-0.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate?
The IUPAC name of methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate (CID 62839439) is methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate.
What is the SMILES notation for methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate?
The canonical SMILES for methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate is COC(=O)C(NC(=O)CN1CCCNCC1)C(C)C.
What is the InChIKey of methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate?
The InChIKey is ZUVQPNMHGBAONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O3/c1-10(2)12(13(18)19-3)15-11(17)9-16-7-4-5-14-6-8-16/h10,12,14H,4-9H2,1-3H3,(H,15,17).
What are the key properties of methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate?
methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate has a molecular weight of 271.36 g/mol, XLogP of -0.40, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(1,4-diazepan-1-yl)acetyl]amino]-3-methylbutanoate is sourced from PubChem (CID 62839439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).