C9H17BrN2O2 — CID 81100239
methyl 2-bromo-3-(1,4-diazepan-1-yl)propanoate (PubChem CID 81100239) has the molecular formula C9H17BrN2O2 and a molecular weight of 265.15 g/mol. Its IUPAC name is methyl 2-bromo-3-(1,4-diazepan-1-yl)propanoate.
| Compound Name | methyl 2-bromo-3-(1,4-diazepan-1-yl)propanoate |
|---|---|
| PubChem CID | 81100239 |
| Molecular Formula | C9H17BrN2O2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | methyl 2-bromo-3-(1,4-diazepan-1-yl)propanoate |
| SMILES | COC(=O)C(Br)CN1CCCNCC1 |
| InChI | InChI=1S/C9H17BrN2O2/c1-14-9(13)8(10)7-12-5-2-3-11-4-6-12/h8,11H,2-7H2,1H3 |
| InChIKey | WDVBBTMBQRKCOO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|