C17H34N4O3 — CID 10831185
[2-hydroxy-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propyl] 2-methylprop-2-enoate (PubChem CID 10831185) has the molecular formula C17H34N4O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [2-hydroxy-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10831185 |
| Molecular Formula | C17H34N4O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | [2-hydroxy-3-(1,4,8,11-tetrazacyclotetradec-1-yl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CN1CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C17H34N4O3/c1-15(2)17(23)24-14-16(22)13-21-11-4-7-19-9-8-18-5-3-6-20-10-12-21/h16,18-20,22H,1,3-14H2,2H3 |
| InChIKey | BHBBFHVUVUFCJR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|