C9H19N3S — CID 82162730
3-(1,4-diazepan-1-yl)-2-methylpropanethioamide (PubChem CID 82162730) has the molecular formula C9H19N3S and a molecular weight of 201.34 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-yl)-2-methylpropanethioamide.
| Compound Name | 3-(1,4-diazepan-1-yl)-2-methylpropanethioamide |
|---|---|
| PubChem CID | 82162730 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-(1,4-diazepan-1-yl)-2-methylpropanethioamide |
| SMILES | CC(CN1CCCNCC1)C(N)=S |
| InChI | InChI=1S/C9H19N3S/c1-8(9(10)13)7-12-5-2-3-11-4-6-12/h8,11H,2-7H2,1H3,(H2,10,13) |
| InChIKey | MAWKCUYGRGVGRZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|