C12H24N4O — CID 82511421
2-methyl-1,3-di(piperazin-1-yl)propan-1-one (PubChem CID 82511421) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-methyl-1,3-di(piperazin-1-yl)propan-1-one.
| Compound Name | 2-methyl-1,3-di(piperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 82511421 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 2-methyl-1,3-di(piperazin-1-yl)propan-1-one |
| SMILES | CC(CN1CCNCC1)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H24N4O/c1-11(10-15-6-2-13-3-7-15)12(17)16-8-4-14-5-9-16/h11,13-14H,2-10H2,1H3 |
| InChIKey | XXQFDXSPSYXCEN-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |