C11H23N5O — CID 82511538
2-amino-1,3-di(piperazin-1-yl)propan-1-one (PubChem CID 82511538) has the molecular formula C11H23N5O and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-amino-1,3-di(piperazin-1-yl)propan-1-one.
| Compound Name | 2-amino-1,3-di(piperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 82511538 |
| Molecular Formula | C11H23N5O |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 2-amino-1,3-di(piperazin-1-yl)propan-1-one |
| SMILES | NC(CN1CCNCC1)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H23N5O/c12-10(9-15-5-1-13-2-6-15)11(17)16-7-3-14-4-8-16/h10,13-14H,1-9,12H2 |
| InChIKey | RHWNIOHAKUSKTE-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |