C6H12F2N2 — CID 19622797
1-(2,2-difluoroethyl)piperazine (PubChem CID 19622797) has the molecular formula C6H12F2N2 and a molecular weight of 150.17 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)piperazine.
| Compound Name | 1-(2,2-difluoroethyl)piperazine |
|---|---|
| PubChem CID | 19622797 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)piperazine |
| SMILES | FC(F)CN1CCNCC1 |
| InChI | InChI=1S/C6H12F2N2/c7-6(8)5-10-3-1-9-2-4-10/h6,9H,1-5H2 |
| InChIKey | JIARBLBYLGYCBZ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |