C9H18F2N2 — CID 172843294
1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane (PubChem CID 172843294) has the molecular formula C9H18F2N2 and a molecular weight of 192.25 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane.
| Compound Name | 1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane |
|---|---|
| PubChem CID | 172843294 |
| Molecular Formula | C9H18F2N2 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-(2,2-difluoroethyl)-7-ethyl-1,4-diazepane |
| SMILES | CCC1CCNCCN1CC(F)F |
| InChI | InChI=1S/C9H18F2N2/c1-2-8-3-4-12-5-6-13(8)7-9(10)11/h8-9,12H,2-7H2,1H3 |
| InChIKey | XBWFPNWJAQYJTM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |