C8H17F2NS — CID 163270154
1-(2,2-difluoroethyl)-2-ethylazetidine;methanethiol (PubChem CID 163270154) has the molecular formula C8H17F2NS and a molecular weight of 197.29 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-ethylazetidine;methanethiol.
| Compound Name | 1-(2,2-difluoroethyl)-2-ethylazetidine;methanethiol |
|---|---|
| PubChem CID | 163270154 |
| Molecular Formula | C8H17F2NS |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-ethylazetidine;methanethiol |
| SMILES | CCC1CCN1CC(F)F.CS |
| InChI | InChI=1S/C7H13F2N.CH4S/c1-2-6-3-4-10(6)5-7(8)9;1-2/h6-7H,2-5H2,1H3;2H,1H3 |
| InChIKey | TTZOGXAFHRYPOO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|