C7H20Cl2N2 — CID 175211859
azane;1,2-diethylazetidine;dihydrochloride (PubChem CID 175211859) has the molecular formula C7H20Cl2N2 and a molecular weight of 203.16 g/mol. Its IUPAC name is azane;1,2-diethylazetidine;dihydrochloride.
| Compound Name | azane;1,2-diethylazetidine;dihydrochloride |
|---|---|
| PubChem CID | 175211859 |
| Molecular Formula | C7H20Cl2N2 |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | azane;1,2-diethylazetidine;dihydrochloride |
| SMILES | CCC1CCN1CC.Cl.Cl.N |
| InChI | InChI=1S/C7H15N.2ClH.H3N/c1-3-7-5-6-8(7)4-2;;;/h7H,3-6H2,1-2H3;2*1H;1H3 |
| InChIKey | RQZPLMVBHAFYBR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |