C9H19N — CID 19604037
1,2-diethylpiperidine (PubChem CID 19604037) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 1,2-diethylpiperidine.
| Compound Name | 1,2-diethylpiperidine |
|---|---|
| PubChem CID | 19604037 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1,2-diethylpiperidine |
| SMILES | CCC1CCCCN1CC |
| InChI | InChI=1S/C9H19N/c1-3-9-7-5-6-8-10(9)4-2/h9H,3-8H2,1-2H3 |
| InChIKey | LQCZNKVBDCESJY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |