C15H34N6 — CID 22495519
1-[1-(1,4,7-triazonan-1-yl)propan-2-yl]-1,4,7-triazonane (PubChem CID 22495519) has the molecular formula C15H34N6 and a molecular weight of 298.48 g/mol. Its IUPAC name is 1-[1-(1,4,7-triazonan-1-yl)propan-2-yl]-1,4,7-triazonane.
| Compound Name | 1-[1-(1,4,7-triazonan-1-yl)propan-2-yl]-1,4,7-triazonane |
|---|---|
| PubChem CID | 22495519 |
| Molecular Formula | C15H34N6 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.28 |
| IUPAC Name | 1-[1-(1,4,7-triazonan-1-yl)propan-2-yl]-1,4,7-triazonane |
| SMILES | CC(CN1CCNCCNCC1)N1CCNCCNCC1 |
| InChI | InChI=1S/C15H34N6/c1-15(21-12-8-18-4-5-19-9-13-21)14-20-10-6-16-2-3-17-7-11-20/h15-19H,2-14H2,1H3 |
| InChIKey | NMUNRKIEYRGXOS-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |